About (2S,5R)-5-(chloromethyl)-2-(4-chlorophenyl)-1,3-oxazolidin-3-ium
(2S,5R)-5-(chloromethyl)-2-(4-chlorophenyl)-1,3-oxazolidin-3-ium (PubChem CID 7127704) has the molecular formula C10H12Cl2NO+
and a molecular weight of 233.12 g/mol. Its IUPAC name is (2S,5R)-5-(chloromethyl)-2-(4-chlorophenyl)-1,3-oxazolidin-3-ium.
Molecular Properties
| Compound Name | (2S,5R)-5-(chloromethyl)-2-(4-chlorophenyl)-1,3-oxazolidin-3-ium |
| PubChem CID | 7127704 |
| Molecular Formula | C10H12Cl2NO+ |
| Molecular Weight | 233.12 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | (2S,5R)-5-(chloromethyl)-2-(4-chlorophenyl)-1,3-oxazolidin-3-ium |
| SMILES | ClC[C@H]1C[NH2+][C@H](c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C10H11Cl2NO/c11-5-9-6-13-10(14-9)7-1-3-8(12)4-2-7/h1-4,9-10,13H,5-6H2/p+1/t9-,10-/m0/s1 |
| InChIKey | XJJPFRUMIOXIRJ-UWVGGRQHSA-O |
| XLogP | 1.54 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.12 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S,5R)-5-(chloromethyl)-2-(4-chlorophenyl)-1,3-oxazolidin-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-5-(chloromethyl)-2-(4-chlorophenyl)-1,3-oxazolidin-3-ium?
The IUPAC name of (2S,5R)-5-(chloromethyl)-2-(4-chlorophenyl)-1,3-oxazolidin-3-ium (CID 7127704) is (2S,5R)-5-(chloromethyl)-2-(4-chlorophenyl)-1,3-oxazolidin-3-ium.
What is the SMILES notation for (2S,5R)-5-(chloromethyl)-2-(4-chlorophenyl)-1,3-oxazolidin-3-ium?
The canonical SMILES for (2S,5R)-5-(chloromethyl)-2-(4-chlorophenyl)-1,3-oxazolidin-3-ium is ClC[C@H]1C[NH2+][C@H](c2ccc(Cl)cc2)O1.
What is the InChIKey of (2S,5R)-5-(chloromethyl)-2-(4-chlorophenyl)-1,3-oxazolidin-3-ium?
The InChIKey is XJJPFRUMIOXIRJ-UWVGGRQHSA-O. The full InChI is InChI=1S/C10H11Cl2NO/c11-5-9-6-13-10(14-9)7-1-3-8(12)4-2-7/h1-4,9-10,13H,5-6H2/p+1/t9-,10-/m0/s1.
What are the key properties of (2S,5R)-5-(chloromethyl)-2-(4-chlorophenyl)-1,3-oxazolidin-3-ium?
(2S,5R)-5-(chloromethyl)-2-(4-chlorophenyl)-1,3-oxazolidin-3-ium has a molecular weight of 233.12 g/mol, XLogP of 1.54, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-5-(chloromethyl)-2-(4-chlorophenyl)-1,3-oxazolidin-3-ium is sourced from PubChem (CID 7127704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).