C22H22ClF3N2O2 — CID 71277080
2-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-[4-methoxy-3-(trifluoromethyl)phenyl]ethanol (PubChem CID 71277080) has the molecular formula C22H22ClF3N2O2 and a molecular weight of 438.88 g/mol. Its IUPAC name is 2-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-[4-methoxy-3-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 2-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-[4-methoxy-3-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 71277080 |
| Molecular Formula | C22H22ClF3N2O2 |
| Molecular Weight | 438.88 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 2-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-[4-methoxy-3-(trifluoromethyl)phenyl]ethanol |
| SMILES | COc1ccc(C(O)Cn2c3c(c4cc(Cl)ccc42)CN(C)CC3)cc1C(F)(F)F |
| InChI | InChI=1S/C22H22ClF3N2O2/c1-27-8-7-19-16(11-27)15-10-14(23)4-5-18(15)28(19)12-20(29)13-3-6-21(30-2)17(9-13)22(24,25)26/h3-6,9-10,20,29H,7-8,11-12H2,1-2H3 |
| InChIKey | KBKUFOFVDHKSGP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 37.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.88 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|