C22H34BNO4 — CID 71277120
2-[4-[[2-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-1-yl]acetic acid (PubChem CID 71277120) has the molecular formula C22H34BNO4 and a molecular weight of 387.33 g/mol. Its IUPAC name is 2-[4-[[2-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[[2-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 71277120 |
| Molecular Formula | C22H34BNO4 |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | 2-[4-[[2-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-1-yl]acetic acid |
| SMILES | CCc1c(CC2CCN(CC(=O)O)CC2)cccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H34BNO4/c1-6-18-17(14-16-10-12-24(13-11-16)15-20(25)26)8-7-9-19(18)23-27-21(2,3)22(4,5)28-23/h7-9,16H,6,10-15H2,1-5H3,(H,25,26) |
| InChIKey | KBHMNDRXILVJDU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|