C20H24F2N2O4S — CID 71277428
(7S)-6-(2,6-difluorophenyl)sulfonyl-7-[(2-methylpropan-2-yl)oxymethyl]-5,7,8,10-tetrahydropyrido[3,2-f][1,4]oxazocine (PubChem CID 71277428) has the molecular formula C20H24F2N2O4S and a molecular weight of 426.49 g/mol. Its IUPAC name is (7S)-6-(2,6-difluorophenyl)sulfonyl-7-[(2-methylpropan-2-yl)oxymethyl]-5,7,8,10-tetrahydropyrido[3,2-f][1,4]oxazocine.
| Compound Name | (7S)-6-(2,6-difluorophenyl)sulfonyl-7-[(2-methylpropan-2-yl)oxymethyl]-5,7,8,10-tetrahydropyrido[3,2-f][1,4]oxazocine |
|---|---|
| PubChem CID | 71277428 |
| Molecular Formula | C20H24F2N2O4S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | (7S)-6-(2,6-difluorophenyl)sulfonyl-7-[(2-methylpropan-2-yl)oxymethyl]-5,7,8,10-tetrahydropyrido[3,2-f][1,4]oxazocine |
| SMILES | CC(C)(C)OC[C@@H]1COCc2ncccc2CN1S(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C20H24F2N2O4S/c1-20(2,3)28-12-15-11-27-13-18-14(6-5-9-23-18)10-24(15)29(25,26)19-16(21)7-4-8-17(19)22/h4-9,15H,10-13H2,1-3H3/t15-/m0/s1 |
| InChIKey | KBROPBOPHGZSRM-HNNXBMFYSA-N |
| XLogP | 3.26 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |