C21H23F2N3O2 — CID 71277732
2-[3-(difluoromethyl)-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]-1-pyridin-3-ylethane-1,1-diol (PubChem CID 71277732) has the molecular formula C21H23F2N3O2 and a molecular weight of 387.43 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]-1-pyridin-3-ylethane-1,1-diol.
| Compound Name | 2-[3-(difluoromethyl)-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]-1-pyridin-3-ylethane-1,1-diol |
|---|---|
| PubChem CID | 71277732 |
| Molecular Formula | C21H23F2N3O2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-[3-(difluoromethyl)-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]-1-pyridin-3-ylethane-1,1-diol |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(O)(O)c2cccnc2)CC(C(F)F)N(C)C1 |
| InChI | InChI=1S/C21H23F2N3O2/c1-13-5-6-17-15(8-13)16-11-25(2)19(20(22)23)9-18(16)26(17)12-21(27,28)14-4-3-7-24-10-14/h3-8,10,19-20,27-28H,9,11-12H2,1-2H3 |
| InChIKey | CLVWHSZGXCUSTJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|