C18H19FN4OS — CID 71277799
(4R,4aR,8aS)-8a-(2-fluoro-5-pyrimidin-5-ylphenyl)-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 71277799) has the molecular formula C18H19FN4OS and a molecular weight of 358.44 g/mol. Its IUPAC name is (4R,4aR,8aS)-8a-(2-fluoro-5-pyrimidin-5-ylphenyl)-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4R,4aR,8aS)-8a-(2-fluoro-5-pyrimidin-5-ylphenyl)-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 71277799 |
| Molecular Formula | C18H19FN4OS |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (4R,4aR,8aS)-8a-(2-fluoro-5-pyrimidin-5-ylphenyl)-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | C[C@H]1SC(N)=N[C@@]2(c3cc(-c4cncnc4)ccc3F)COCC[C@@H]12 |
| InChI | InChI=1S/C18H19FN4OS/c1-11-14-4-5-24-9-18(14,23-17(20)25-11)15-6-12(2-3-16(15)19)13-7-21-10-22-8-13/h2-3,6-8,10-11,14H,4-5,9H2,1H3,(H2,20,23)/t11-,14+,18+/m1/s1 |
| InChIKey | ACZODTCKQQJIBF-VZSAFFHGSA-N |
| XLogP | 2.96 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |