C11H21N4PS — CID 71277802
[2,3,5,6-tetramethyl-4-(3-methyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]phosphane (PubChem CID 71277802) has the molecular formula C11H21N4PS and a molecular weight of 272.36 g/mol. Its IUPAC name is [2,3,5,6-tetramethyl-4-(3-methyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]phosphane.
| Compound Name | [2,3,5,6-tetramethyl-4-(3-methyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]phosphane |
|---|---|
| PubChem CID | 71277802 |
| Molecular Formula | C11H21N4PS |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | [2,3,5,6-tetramethyl-4-(3-methyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]phosphane |
| SMILES | Cc1nsc(N2C(C)C(C)N(P)C(C)C2C)n1 |
| InChI | InChI=1S/C11H21N4PS/c1-6-8(3)15(16)9(4)7(2)14(6)11-12-10(5)13-17-11/h6-9H,16H2,1-5H3 |
| InChIKey | MROLRBFSCYASKX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|