C17H25N2O3+ — CID 7127794
tert-butyl 4-[(3-formylphenyl)methyl]piperazin-4-ium-1-carboxylate (PubChem CID 7127794) has the molecular formula C17H25N2O3+ and a molecular weight of 305.40 g/mol. Its IUPAC name is tert-butyl 4-[(3-formylphenyl)methyl]piperazin-4-ium-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-formylphenyl)methyl]piperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 7127794 |
| Molecular Formula | C17H25N2O3+ |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | tert-butyl 4-[(3-formylphenyl)methyl]piperazin-4-ium-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[NH+](Cc2cccc(C=O)c2)CC1 |
| InChI | InChI=1S/C17H24N2O3/c1-17(2,3)22-16(21)19-9-7-18(8-10-19)12-14-5-4-6-15(11-14)13-20/h4-6,11,13H,7-10,12H2,1-3H3/p+1 |
| InChIKey | YIKZZJRCKPEHGU-UHFFFAOYSA-O |
| XLogP | 1.13 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|