4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid

C10H8N2O3 — CID 7127808

IUPAC4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid
SMILESCc1nc(-c2ccc(C(=O)O)cc2)no1
InChIInChI=1S/C10H8N2O3/c1-6-11-9(12-15-6)7-2-4-8(5-3-7)10(13)14/h2-5H,1H3,(H,13,14)
InChIKeyDTKAUYQBZSOHRJ-UHFFFAOYSA-N
MW204.18 g/mol
LogP1.74
Rot. Bonds2

About 4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid

4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid (PubChem CID 7127808) has the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. Its IUPAC name is 4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid.

Molecular Properties

Compound Name4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid
PubChem CID7127808
Molecular FormulaC10H8N2O3
Molecular Weight204.18 g/mol
Exact Mass204.05
IUPAC Name4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid
SMILESCc1nc(-c2ccc(C(=O)O)cc2)no1
InChIInChI=1S/C10H8N2O3/c1-6-11-9(12-15-6)7-2-4-8(5-3-7)10(13)14/h2-5H,1H3,(H,13,14)
InChIKeyDTKAUYQBZSOHRJ-UHFFFAOYSA-N
XLogP1.74
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.18
LogP ≤ 51.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid?
The IUPAC name of 4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid (CID 7127808) is 4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid.
What is the SMILES notation for 4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid?
The canonical SMILES for 4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid is Cc1nc(-c2ccc(C(=O)O)cc2)no1.
What is the InChIKey of 4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid?
The InChIKey is DTKAUYQBZSOHRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3/c1-6-11-9(12-15-6)7-2-4-8(5-3-7)10(13)14/h2-5H,1H3,(H,13,14).
What are the key properties of 4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid?
4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid has a molecular weight of 204.18 g/mol, XLogP of 1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid is sourced from PubChem (CID 7127808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).