C28H24N4O5 — CID 71278615
4-[[(2Z)-6-hydroxy-3-oxo-2-[(6-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methylidene]-1-benzofuran-7-yl]methyl]piperazine-1-carboxylic acid (PubChem CID 71278615) has the molecular formula C28H24N4O5 and a molecular weight of 496.52 g/mol. Its IUPAC name is 4-[[(2Z)-6-hydroxy-3-oxo-2-[(6-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methylidene]-1-benzofuran-7-yl]methyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[[(2Z)-6-hydroxy-3-oxo-2-[(6-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methylidene]-1-benzofuran-7-yl]methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 71278615 |
| Molecular Formula | C28H24N4O5 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 4-[[(2Z)-6-hydroxy-3-oxo-2-[(6-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methylidene]-1-benzofuran-7-yl]methyl]piperazine-1-carboxylic acid |
| SMILES | O=C1/C(=C/c2c[nH]c3nc(-c4ccccc4)ccc23)Oc2c1ccc(O)c2CN1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C28H24N4O5/c33-23-9-7-20-25(34)24(37-26(20)21(23)16-31-10-12-32(13-11-31)28(35)36)14-18-15-29-27-19(18)6-8-22(30-27)17-4-2-1-3-5-17/h1-9,14-15,33H,10-13,16H2,(H,29,30)(H,35,36)/b24-14- |
| InChIKey | PHJCLDATHMXWMK-OYKKKHCWSA-N |
| XLogP | 4.35 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|