C11H19N3O4Si — CID 71279141
dimethyl 1-(1-trimethylsilylethyl)triazole-4,5-dicarboxylate (PubChem CID 71279141) has the molecular formula C11H19N3O4Si and a molecular weight of 285.38 g/mol. Its IUPAC name is dimethyl 1-(1-trimethylsilylethyl)triazole-4,5-dicarboxylate.
| Compound Name | dimethyl 1-(1-trimethylsilylethyl)triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 71279141 |
| Molecular Formula | C11H19N3O4Si |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | dimethyl 1-(1-trimethylsilylethyl)triazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1nnn(C(C)[Si](C)(C)C)c1C(=O)OC |
| InChI | InChI=1S/C11H19N3O4Si/c1-7(19(4,5)6)14-9(11(16)18-3)8(12-13-14)10(15)17-2/h7H,1-6H3 |
| InChIKey | YFKDZDLZRZEMQT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|