C39H44FN7O2Si — CID 71279371
2-[1-(1-benzhydrylazetidin-3-yl)-6-fluoroindazol-3-yl]-N-propyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71279371) has the molecular formula C39H44FN7O2Si and a molecular weight of 689.91 g/mol. Its IUPAC name is 2-[1-(1-benzhydrylazetidin-3-yl)-6-fluoroindazol-3-yl]-N-propyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-[1-(1-benzhydrylazetidin-3-yl)-6-fluoroindazol-3-yl]-N-propyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71279371 |
| Molecular Formula | C39H44FN7O2Si |
| Molecular Weight | 689.91 g/mol |
| Exact Mass | 689.33 |
| IUPAC Name | 2-[1-(1-benzhydrylazetidin-3-yl)-6-fluoroindazol-3-yl]-N-propyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CCCNC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3nn(C4CN(C(c5ccccc5)c5ccccc5)C4)c4cc(F)ccc34)nc12 |
| InChI | InChI=1S/C39H44FN7O2Si/c1-5-18-41-39(48)32-25-46(26-49-19-20-50(2,3)4)38-36(32)43-33(22-42-38)35-31-17-16-29(40)21-34(31)47(44-35)30-23-45(24-30)37(27-12-8-6-9-13-27)28-14-10-7-11-15-28/h6-17,21-22,25,30,37H,5,18-20,23-24,26H2,1-4H3,(H,41,48) |
| InChIKey | CBXGAUVTMOODIS-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.91 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|