C29H38F2N6O5Si — CID 71279449
4-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-5-(difluoromethoxy)indazol-1-yl]butanoic acid (PubChem CID 71279449) has the molecular formula C29H38F2N6O5Si and a molecular weight of 616.74 g/mol. Its IUPAC name is 4-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-5-(difluoromethoxy)indazol-1-yl]butanoic acid.
| Compound Name | 4-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-5-(difluoromethoxy)indazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 71279449 |
| Molecular Formula | C29H38F2N6O5Si |
| Molecular Weight | 616.74 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | 4-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-5-(difluoromethoxy)indazol-1-yl]butanoic acid |
| SMILES | CC(C)(C)NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3nn(CCCC(=O)O)c4ccc(OC(F)F)cc34)nc12 |
| InChI | InChI=1S/C29H38F2N6O5Si/c1-29(2,3)34-27(40)20-16-36(17-41-12-13-43(4,5)6)26-25(20)33-21(15-32-26)24-19-14-18(42-28(30)31)9-10-22(19)37(35-24)11-7-8-23(38)39/h9-10,14-16,28H,7-8,11-13,17H2,1-6H3,(H,34,40)(H,38,39) |
| InChIKey | AKKLMCPNAXPETP-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.74 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|