C30H41F2N7O5Si — CID 71279450
3-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-5-(difluoromethoxy)indazol-1-yl]propyl-methylcarbamic acid (PubChem CID 71279450) has the molecular formula C30H41F2N7O5Si and a molecular weight of 645.78 g/mol. Its IUPAC name is 3-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-5-(difluoromethoxy)indazol-1-yl]propyl-methylcarbamic acid.
| Compound Name | 3-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-5-(difluoromethoxy)indazol-1-yl]propyl-methylcarbamic acid |
|---|---|
| PubChem CID | 71279450 |
| Molecular Formula | C30H41F2N7O5Si |
| Molecular Weight | 645.78 g/mol |
| Exact Mass | 645.29 |
| IUPAC Name | 3-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-5-(difluoromethoxy)indazol-1-yl]propyl-methylcarbamic acid |
| SMILES | CN(CCCn1nc(-c2cnc3c(n2)c(C(=O)NC(C)(C)C)cn3COCC[Si](C)(C)C)c2cc(OC(F)F)ccc21)C(=O)O |
| InChI | InChI=1S/C30H41F2N7O5Si/c1-30(2,3)35-27(40)21-17-38(18-43-13-14-45(5,6)7)26-25(21)34-22(16-33-26)24-20-15-19(44-28(31)32)9-10-23(20)39(36-24)12-8-11-37(4)29(41)42/h9-10,15-17,28H,8,11-14,18H2,1-7H3,(H,35,40)(H,41,42) |
| InChIKey | KINKLSICAHVBNV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.78 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|