C47H53FN6O3Si — CID 71279489
N-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-[6-fluoro-1-(3-hydroxybutyl)indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71279489) has the molecular formula C47H53FN6O3Si and a molecular weight of 797.06 g/mol. Its IUPAC name is N-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-[6-fluoro-1-(3-hydroxybutyl)indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-[6-fluoro-1-(3-hydroxybutyl)indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71279489 |
| Molecular Formula | C47H53FN6O3Si |
| Molecular Weight | 797.06 g/mol |
| Exact Mass | 796.39 |
| IUPAC Name | N-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-[6-fluoro-1-(3-hydroxybutyl)indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(O)CCn1nc(-c2cnc3c(n2)c(C(=O)NC(C)(C)CO[Si](C)(C)C(C)(C)C)cn3C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccc(F)cc21 |
| InChI | InChI=1S/C47H53FN6O3Si/c1-32(55)26-27-54-40-28-36(48)24-25-37(40)41(52-54)39-29-49-43-42(50-39)38(44(56)51-46(5,6)31-57-58(7,8)45(2,3)4)30-53(43)47(33-18-12-9-13-19-33,34-20-14-10-15-21-34)35-22-16-11-17-23-35/h9-25,28-30,32,55H,26-27,31H2,1-8H3,(H,51,56) |
| InChIKey | KHXBXDWGNAAWAF-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.06 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|