C25H32F2N6O3Si — CID 71279566
N-tert-butyl-2-[5-(difluoromethoxy)-1H-indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71279566) has the molecular formula C25H32F2N6O3Si and a molecular weight of 530.65 g/mol. Its IUPAC name is N-tert-butyl-2-[5-(difluoromethoxy)-1H-indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-tert-butyl-2-[5-(difluoromethoxy)-1H-indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71279566 |
| Molecular Formula | C25H32F2N6O3Si |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | N-tert-butyl-2-[5-(difluoromethoxy)-1H-indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3n[nH]c4ccc(OC(F)F)cc34)nc12 |
| InChI | InChI=1S/C25H32F2N6O3Si/c1-25(2,3)30-23(34)17-13-33(14-35-9-10-37(4,5)6)22-21(17)29-19(12-28-22)20-16-11-15(36-24(26)27)7-8-18(16)31-32-20/h7-8,11-13,24H,9-10,14H2,1-6H3,(H,30,34)(H,31,32) |
| InChIKey | ODNMDPUECXFZKP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|