C24H31ClN6O2Si — CID 71279575
N-tert-butyl-2-(6-chloroimidazo[1,5-a]pyridin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71279575) has the molecular formula C24H31ClN6O2Si and a molecular weight of 499.09 g/mol. Its IUPAC name is N-tert-butyl-2-(6-chloroimidazo[1,5-a]pyridin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-tert-butyl-2-(6-chloroimidazo[1,5-a]pyridin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71279575 |
| Molecular Formula | C24H31ClN6O2Si |
| Molecular Weight | 499.09 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | N-tert-butyl-2-(6-chloroimidazo[1,5-a]pyridin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3ncn4cc(Cl)ccc34)nc12 |
| InChI | InChI=1S/C24H31ClN6O2Si/c1-24(2,3)29-23(32)17-13-31(15-33-9-10-34(4,5)6)22-20(17)28-18(11-26-22)21-19-8-7-16(25)12-30(19)14-27-21/h7-8,11-14H,9-10,15H2,1-6H3,(H,29,32) |
| InChIKey | HTKLZRTZRUBPSW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.09 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|