C30H38F2N8O3Si — CID 71279583
N-tert-butyl-2-[5-(difluoromethoxy)-1-[1-(1H-pyrazol-4-yl)ethyl]indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71279583) has the molecular formula C30H38F2N8O3Si and a molecular weight of 624.77 g/mol. Its IUPAC name is N-tert-butyl-2-[5-(difluoromethoxy)-1-[1-(1H-pyrazol-4-yl)ethyl]indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-tert-butyl-2-[5-(difluoromethoxy)-1-[1-(1H-pyrazol-4-yl)ethyl]indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71279583 |
| Molecular Formula | C30H38F2N8O3Si |
| Molecular Weight | 624.77 g/mol |
| Exact Mass | 624.28 |
| IUPAC Name | N-tert-butyl-2-[5-(difluoromethoxy)-1-[1-(1H-pyrazol-4-yl)ethyl]indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(c1cn[nH]c1)n1nc(-c2cnc3c(n2)c(C(=O)NC(C)(C)C)cn3COCC[Si](C)(C)C)c2cc(OC(F)F)ccc21 |
| InChI | InChI=1S/C30H38F2N8O3Si/c1-18(19-13-34-35-14-19)40-24-9-8-20(43-29(31)32)12-21(24)25(38-40)23-15-33-27-26(36-23)22(28(41)37-30(2,3)4)16-39(27)17-42-10-11-44(5,6)7/h8-9,12-16,18,29H,10-11,17H2,1-7H3,(H,34,35)(H,37,41) |
| InChIKey | LHNFZSFVNMVMEZ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.77 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|