C24H32N6O2Si — CID 71279603
N-tert-butyl-2-imidazo[1,5-a]pyridin-1-yl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71279603) has the molecular formula C24H32N6O2Si and a molecular weight of 464.65 g/mol. Its IUPAC name is N-tert-butyl-2-imidazo[1,5-a]pyridin-1-yl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-tert-butyl-2-imidazo[1,5-a]pyridin-1-yl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71279603 |
| Molecular Formula | C24H32N6O2Si |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | N-tert-butyl-2-imidazo[1,5-a]pyridin-1-yl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3ncn4ccccc34)nc12 |
| InChI | InChI=1S/C24H32N6O2Si/c1-24(2,3)28-23(31)17-14-30(16-32-11-12-33(4,5)6)22-20(17)27-18(13-25-22)21-19-9-7-8-10-29(19)15-26-21/h7-10,13-15H,11-12,16H2,1-6H3,(H,28,31) |
| InChIKey | DHJWXNFJPCZQBV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|