C37H47F2N7O4Si — CID 71279606
2-[1-[(4-benzylmorpholin-2-yl)methyl]-5-(difluoromethoxy)indazol-3-yl]-N-tert-butyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71279606) has the molecular formula C37H47F2N7O4Si and a molecular weight of 719.91 g/mol. Its IUPAC name is 2-[1-[(4-benzylmorpholin-2-yl)methyl]-5-(difluoromethoxy)indazol-3-yl]-N-tert-butyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-[1-[(4-benzylmorpholin-2-yl)methyl]-5-(difluoromethoxy)indazol-3-yl]-N-tert-butyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71279606 |
| Molecular Formula | C37H47F2N7O4Si |
| Molecular Weight | 719.91 g/mol |
| Exact Mass | 719.34 |
| IUPAC Name | 2-[1-[(4-benzylmorpholin-2-yl)methyl]-5-(difluoromethoxy)indazol-3-yl]-N-tert-butyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3nn(CC4CN(Cc5ccccc5)CCO4)c4ccc(OC(F)F)cc34)nc12 |
| InChI | InChI=1S/C37H47F2N7O4Si/c1-37(2,3)42-35(47)29-23-45(24-48-16-17-51(4,5)6)34-33(29)41-30(19-40-34)32-28-18-26(50-36(38)39)12-13-31(28)46(43-32)22-27-21-44(14-15-49-27)20-25-10-8-7-9-11-25/h7-13,18-19,23,27,36H,14-17,20-22,24H2,1-6H3,(H,42,47) |
| InChIKey | OWZRBVVZNONUSJ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.91 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|