C30H40FN7O4Si — CID 71279675
3-[2-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-6-fluoroindazol-1-yl]ethyl]azetidine-1-carboxylic acid (PubChem CID 71279675) has the molecular formula C30H40FN7O4Si and a molecular weight of 609.78 g/mol. Its IUPAC name is 3-[2-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-6-fluoroindazol-1-yl]ethyl]azetidine-1-carboxylic acid.
| Compound Name | 3-[2-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-6-fluoroindazol-1-yl]ethyl]azetidine-1-carboxylic acid |
|---|---|
| PubChem CID | 71279675 |
| Molecular Formula | C30H40FN7O4Si |
| Molecular Weight | 609.78 g/mol |
| Exact Mass | 609.29 |
| IUPAC Name | 3-[2-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-6-fluoroindazol-1-yl]ethyl]azetidine-1-carboxylic acid |
| SMILES | CC(C)(C)NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3nn(CCC4CN(C(=O)O)C4)c4cc(F)ccc34)nc12 |
| InChI | InChI=1S/C30H40FN7O4Si/c1-30(2,3)34-28(39)22-17-37(18-42-11-12-43(4,5)6)27-26(22)33-23(14-32-27)25-21-8-7-20(31)13-24(21)38(35-25)10-9-19-15-36(16-19)29(40)41/h7-8,13-14,17,19H,9-12,15-16,18H2,1-6H3,(H,34,39)(H,40,41) |
| InChIKey | JRWQHBVDYPSYSJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 127.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.78 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|