C30H40F2N6O5Si — CID 71279688
methyl 4-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-5-(difluoromethoxy)indazol-1-yl]butanoate (PubChem CID 71279688) has the molecular formula C30H40F2N6O5Si and a molecular weight of 630.77 g/mol. Its IUPAC name is methyl 4-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-5-(difluoromethoxy)indazol-1-yl]butanoate.
| Compound Name | methyl 4-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-5-(difluoromethoxy)indazol-1-yl]butanoate |
|---|---|
| PubChem CID | 71279688 |
| Molecular Formula | C30H40F2N6O5Si |
| Molecular Weight | 630.77 g/mol |
| Exact Mass | 630.28 |
| IUPAC Name | methyl 4-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-5-(difluoromethoxy)indazol-1-yl]butanoate |
| SMILES | COC(=O)CCCn1nc(-c2cnc3c(n2)c(C(=O)NC(C)(C)C)cn3COCC[Si](C)(C)C)c2cc(OC(F)F)ccc21 |
| InChI | InChI=1S/C30H40F2N6O5Si/c1-30(2,3)35-28(40)21-17-37(18-42-13-14-44(5,6)7)27-26(21)34-22(16-33-27)25-20-15-19(43-29(31)32)10-11-23(20)38(36-25)12-8-9-24(39)41-4/h10-11,15-17,29H,8-9,12-14,18H2,1-7H3,(H,35,40) |
| InChIKey | CBIYGYWSUXXWGC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.77 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|