C26H33FN6O3Si — CID 71279698
2-[6-fluoro-1-(oxetan-3-yl)indazol-3-yl]-N-propan-2-yl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71279698) has the molecular formula C26H33FN6O3Si and a molecular weight of 524.67 g/mol. Its IUPAC name is 2-[6-fluoro-1-(oxetan-3-yl)indazol-3-yl]-N-propan-2-yl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-[6-fluoro-1-(oxetan-3-yl)indazol-3-yl]-N-propan-2-yl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71279698 |
| Molecular Formula | C26H33FN6O3Si |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | 2-[6-fluoro-1-(oxetan-3-yl)indazol-3-yl]-N-propan-2-yl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3nn(C4COC4)c4cc(F)ccc34)nc12 |
| InChI | InChI=1S/C26H33FN6O3Si/c1-16(2)29-26(34)20-12-32(15-35-8-9-37(3,4)5)25-24(20)30-21(11-28-25)23-19-7-6-17(27)10-22(19)33(31-23)18-13-36-14-18/h6-7,10-12,16,18H,8-9,13-15H2,1-5H3,(H,29,34) |
| InChIKey | NNKBJZHEQPCCEF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|