C21H23F2N5O3Si — CID 71279701
2-(4,6-difluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid (PubChem CID 71279701) has the molecular formula C21H23F2N5O3Si and a molecular weight of 459.53 g/mol. Its IUPAC name is 2-(4,6-difluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid.
| Compound Name | 2-(4,6-difluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
|---|---|
| PubChem CID | 71279701 |
| Molecular Formula | C21H23F2N5O3Si |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 2-(4,6-difluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
| SMILES | Cn1nc(-c2cnc3c(n2)c(C(=O)O)cn3COCC[Si](C)(C)C)c2c(F)cc(F)cc21 |
| InChI | InChI=1S/C21H23F2N5O3Si/c1-27-16-8-12(22)7-14(23)17(16)19(26-27)15-9-24-20-18(25-15)13(21(29)30)10-28(20)11-31-5-6-32(2,3)4/h7-10H,5-6,11H2,1-4H3,(H,29,30) |
| InChIKey | KYNQFSVYBXZVPX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|