C20H22FN5O3Si — CID 71279746
2-(6-fluoroimidazo[1,5-a]pyridin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid (PubChem CID 71279746) has the molecular formula C20H22FN5O3Si and a molecular weight of 427.51 g/mol. Its IUPAC name is 2-(6-fluoroimidazo[1,5-a]pyridin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid.
| Compound Name | 2-(6-fluoroimidazo[1,5-a]pyridin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
|---|---|
| PubChem CID | 71279746 |
| Molecular Formula | C20H22FN5O3Si |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 2-(6-fluoroimidazo[1,5-a]pyridin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1cc(C(=O)O)c2nc(-c3ncn4cc(F)ccc34)cnc21 |
| InChI | InChI=1S/C20H22FN5O3Si/c1-30(2,3)7-6-29-12-26-10-14(20(27)28)17-19(26)22-8-15(24-17)18-16-5-4-13(21)9-25(16)11-23-18/h4-5,8-11H,6-7,12H2,1-3H3,(H,27,28) |
| InChIKey | LBNMYKYNBDUKCI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|