C30H41F2N7O3Si — CID 71279838
N-tert-butyl-2-[5-(difluoromethoxy)-1-piperidin-4-ylindazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71279838) has the molecular formula C30H41F2N7O3Si and a molecular weight of 613.79 g/mol. Its IUPAC name is N-tert-butyl-2-[5-(difluoromethoxy)-1-piperidin-4-ylindazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-tert-butyl-2-[5-(difluoromethoxy)-1-piperidin-4-ylindazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71279838 |
| Molecular Formula | C30H41F2N7O3Si |
| Molecular Weight | 613.79 g/mol |
| Exact Mass | 613.30 |
| IUPAC Name | N-tert-butyl-2-[5-(difluoromethoxy)-1-piperidin-4-ylindazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3nn(C4CCNCC4)c4ccc(OC(F)F)cc34)nc12 |
| InChI | InChI=1S/C30H41F2N7O3Si/c1-30(2,3)36-28(40)22-17-38(18-41-13-14-43(4,5)6)27-26(22)35-23(16-34-27)25-21-15-20(42-29(31)32)7-8-24(21)39(37-25)19-9-11-33-12-10-19/h7-8,15-17,19,29,33H,9-14,18H2,1-6H3,(H,36,40) |
| InChIKey | ITIBGKBXKATARH-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.79 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|