C20H23N5O3Si — CID 71279847
2-imidazo[1,2-a]pyridin-3-yl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid (PubChem CID 71279847) has the molecular formula C20H23N5O3Si and a molecular weight of 409.52 g/mol. Its IUPAC name is 2-imidazo[1,2-a]pyridin-3-yl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid.
| Compound Name | 2-imidazo[1,2-a]pyridin-3-yl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
|---|---|
| PubChem CID | 71279847 |
| Molecular Formula | C20H23N5O3Si |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-imidazo[1,2-a]pyridin-3-yl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1cc(C(=O)O)c2nc(-c3cnc4ccccn34)cnc21 |
| InChI | InChI=1S/C20H23N5O3Si/c1-29(2,3)9-8-28-13-24-12-14(20(26)27)18-19(24)22-10-15(23-18)16-11-21-17-6-4-5-7-25(16)17/h4-7,10-12H,8-9,13H2,1-3H3,(H,26,27) |
| InChIKey | QQANJFKVHVVJHJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|