C30H41F2N7O4Si — CID 71279850
N-tert-butyl-2-[5-(difluoromethoxy)-1-(morpholin-2-ylmethyl)indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71279850) has the molecular formula C30H41F2N7O4Si and a molecular weight of 629.79 g/mol. Its IUPAC name is N-tert-butyl-2-[5-(difluoromethoxy)-1-(morpholin-2-ylmethyl)indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-tert-butyl-2-[5-(difluoromethoxy)-1-(morpholin-2-ylmethyl)indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71279850 |
| Molecular Formula | C30H41F2N7O4Si |
| Molecular Weight | 629.79 g/mol |
| Exact Mass | 629.30 |
| IUPAC Name | N-tert-butyl-2-[5-(difluoromethoxy)-1-(morpholin-2-ylmethyl)indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3nn(CC4CNCCO4)c4ccc(OC(F)F)cc34)nc12 |
| InChI | InChI=1S/C30H41F2N7O4Si/c1-30(2,3)36-28(40)22-17-38(18-41-11-12-44(4,5)6)27-26(22)35-23(15-34-27)25-21-13-19(43-29(31)32)7-8-24(21)39(37-25)16-20-14-33-9-10-42-20/h7-8,13,15,17,20,29,33H,9-12,14,16,18H2,1-6H3,(H,36,40) |
| InChIKey | BCZFNEFIDJRPNZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.79 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|