C28H40FN7O2Si — CID 71279864
N-tert-butyl-2-[1-[2-(dimethylamino)ethyl]-6-fluoroindazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71279864) has the molecular formula C28H40FN7O2Si and a molecular weight of 553.76 g/mol. Its IUPAC name is N-tert-butyl-2-[1-[2-(dimethylamino)ethyl]-6-fluoroindazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-tert-butyl-2-[1-[2-(dimethylamino)ethyl]-6-fluoroindazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71279864 |
| Molecular Formula | C28H40FN7O2Si |
| Molecular Weight | 553.76 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | N-tert-butyl-2-[1-[2-(dimethylamino)ethyl]-6-fluoroindazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CN(C)CCn1nc(-c2cnc3c(n2)c(C(=O)NC(C)(C)C)cn3COCC[Si](C)(C)C)c2ccc(F)cc21 |
| InChI | InChI=1S/C28H40FN7O2Si/c1-28(2,3)32-27(37)21-17-35(18-38-13-14-39(6,7)8)26-25(21)31-22(16-30-26)24-20-10-9-19(29)15-23(20)36(33-24)12-11-34(4)5/h9-10,15-17H,11-14,18H2,1-8H3,(H,32,37) |
| InChIKey | ATZBAMOZTFERDQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.76 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|