C34H48FN7O4Si — CID 71280034
tert-butyl 4-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-6-fluoroindazol-1-yl]piperidine-1-carboxylate (PubChem CID 71280034) has the molecular formula C34H48FN7O4Si and a molecular weight of 665.89 g/mol. Its IUPAC name is tert-butyl 4-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-6-fluoroindazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-6-fluoroindazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71280034 |
| Molecular Formula | C34H48FN7O4Si |
| Molecular Weight | 665.89 g/mol |
| Exact Mass | 665.35 |
| IUPAC Name | tert-butyl 4-[3-[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-6-fluoroindazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3nn(C4CCN(C(=O)OC(C)(C)C)CC4)c4cc(F)ccc34)nc12 |
| InChI | InChI=1S/C34H48FN7O4Si/c1-33(2,3)38-31(43)25-20-41(21-45-16-17-47(7,8)9)30-29(25)37-26(19-36-30)28-24-11-10-22(35)18-27(24)42(39-28)23-12-14-40(15-13-23)32(44)46-34(4,5)6/h10-11,18-20,23H,12-17,21H2,1-9H3,(H,38,43) |
| InChIKey | DIUTUIYHJYFRQR-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.89 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|