C44H45F2N7O2 — CID 71280139
2-[1-(4-amino-4-methylpentyl)-5-(difluoromethoxy)indazol-3-yl]-N-tert-butyl-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71280139) has the molecular formula C44H45F2N7O2 and a molecular weight of 741.89 g/mol. Its IUPAC name is 2-[1-(4-amino-4-methylpentyl)-5-(difluoromethoxy)indazol-3-yl]-N-tert-butyl-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-[1-(4-amino-4-methylpentyl)-5-(difluoromethoxy)indazol-3-yl]-N-tert-butyl-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71280139 |
| Molecular Formula | C44H45F2N7O2 |
| Molecular Weight | 741.89 g/mol |
| Exact Mass | 741.36 |
| IUPAC Name | 2-[1-(4-amino-4-methylpentyl)-5-(difluoromethoxy)indazol-3-yl]-N-tert-butyl-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)(N)CCCn1nc(-c2cnc3c(n2)c(C(=O)NC(C)(C)C)cn3C(c2ccccc2)(c2ccccc2)c2ccccc2)c2cc(OC(F)F)ccc21 |
| InChI | InChI=1S/C44H45F2N7O2/c1-42(2,3)50-40(54)34-28-52(44(29-16-9-6-10-17-29,30-18-11-7-12-19-30)31-20-13-8-14-21-31)39-38(34)49-35(27-48-39)37-33-26-32(55-41(45)46)22-23-36(33)53(51-37)25-15-24-43(4,5)47/h6-14,16-23,26-28,41H,15,24-25,47H2,1-5H3,(H,50,54) |
| InChIKey | FCAMGZAEDUGMOS-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.89 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|