C45H44F2N6O4 — CID 71280145
N-tert-butyl-2-[5-(difluoromethoxy)-1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71280145) has the molecular formula C45H44F2N6O4 and a molecular weight of 770.88 g/mol. Its IUPAC name is N-tert-butyl-2-[5-(difluoromethoxy)-1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-tert-butyl-2-[5-(difluoromethoxy)-1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71280145 |
| Molecular Formula | C45H44F2N6O4 |
| Molecular Weight | 770.88 g/mol |
| Exact Mass | 770.34 |
| IUPAC Name | N-tert-butyl-2-[5-(difluoromethoxy)-1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ncc(-c3nn(CCC4COC(C)(C)O4)c4ccc(OC(F)F)cc34)nc12 |
| InChI | InChI=1S/C45H44F2N6O4/c1-43(2,3)50-41(54)35-27-52(45(29-15-9-6-10-16-29,30-17-11-7-12-18-30)31-19-13-8-14-20-31)40-39(35)49-36(26-48-40)38-34-25-32(56-42(46)47)21-22-37(34)53(51-38)24-23-33-28-55-44(4,5)57-33/h6-22,25-27,33,42H,23-24,28H2,1-5H3,(H,50,54) |
| InChIKey | BJTPHLAESSMFGX-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.88 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|