C20H21F2N5O3Si — CID 71280264
2-(6,8-difluoroimidazo[1,5-a]pyridin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid (PubChem CID 71280264) has the molecular formula C20H21F2N5O3Si and a molecular weight of 445.50 g/mol. Its IUPAC name is 2-(6,8-difluoroimidazo[1,5-a]pyridin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid.
| Compound Name | 2-(6,8-difluoroimidazo[1,5-a]pyridin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
|---|---|
| PubChem CID | 71280264 |
| Molecular Formula | C20H21F2N5O3Si |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 2-(6,8-difluoroimidazo[1,5-a]pyridin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1cc(C(=O)O)c2nc(-c3ncn4cc(F)cc(F)c34)cnc21 |
| InChI | InChI=1S/C20H21F2N5O3Si/c1-31(2,3)5-4-30-11-27-9-13(20(28)29)16-19(27)23-7-15(25-16)17-18-14(22)6-12(21)8-26(18)10-24-17/h6-10H,4-5,11H2,1-3H3,(H,28,29) |
| InChIKey | UCCIZGWUJYBSSC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|