About 3-(2-carboxyethyl)-4,6-diphenyl-1H-indole-2-carboxylic acid
3-(2-carboxyethyl)-4,6-diphenyl-1H-indole-2-carboxylic acid (PubChem CID 71281161) has the molecular formula C24H19NO4
and a molecular weight of 385.42 g/mol. Its IUPAC name is 3-(2-carboxyethyl)-4,6-diphenyl-1H-indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-(2-carboxyethyl)-4,6-diphenyl-1H-indole-2-carboxylic acid |
| PubChem CID | 71281161 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 3-(2-carboxyethyl)-4,6-diphenyl-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)CCc1c(C(=O)O)[nH]c2cc(-c3ccccc3)cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C24H19NO4/c26-21(27)12-11-18-22-19(16-9-5-2-6-10-16)13-17(15-7-3-1-4-8-15)14-20(22)25-23(18)24(28)29/h1-10,13-14,25H,11-12H2,(H,26,27)(H,28,29) |
| InChIKey | SSEVUBMCWYXCTC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-carboxyethyl)-4,6-diphenyl-1H-indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-carboxyethyl)-4,6-diphenyl-1H-indole-2-carboxylic acid?
The IUPAC name of 3-(2-carboxyethyl)-4,6-diphenyl-1H-indole-2-carboxylic acid (CID 71281161) is 3-(2-carboxyethyl)-4,6-diphenyl-1H-indole-2-carboxylic acid.
What is the SMILES notation for 3-(2-carboxyethyl)-4,6-diphenyl-1H-indole-2-carboxylic acid?
The canonical SMILES for 3-(2-carboxyethyl)-4,6-diphenyl-1H-indole-2-carboxylic acid is O=C(O)CCc1c(C(=O)O)[nH]c2cc(-c3ccccc3)cc(-c3ccccc3)c12.
What is the InChIKey of 3-(2-carboxyethyl)-4,6-diphenyl-1H-indole-2-carboxylic acid?
The InChIKey is SSEVUBMCWYXCTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19NO4/c26-21(27)12-11-18-22-19(16-9-5-2-6-10-16)13-17(15-7-3-1-4-8-15)14-20(22)25-23(18)24(28)29/h1-10,13-14,25H,11-12H2,(H,26,27)(H,28,29).
What are the key properties of 3-(2-carboxyethyl)-4,6-diphenyl-1H-indole-2-carboxylic acid?
3-(2-carboxyethyl)-4,6-diphenyl-1H-indole-2-carboxylic acid has a molecular weight of 385.42 g/mol, XLogP of 5.22, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-carboxyethyl)-4,6-diphenyl-1H-indole-2-carboxylic acid is sourced from PubChem (CID 71281161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).