C17H25ClO2Si — CID 71282049
9-[tert-butyl(dimethyl)silyl]oxy-2-chloro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one (PubChem CID 71282049) has the molecular formula C17H25ClO2Si and a molecular weight of 324.92 g/mol. Its IUPAC name is 9-[tert-butyl(dimethyl)silyl]oxy-2-chloro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one.
| Compound Name | 9-[tert-butyl(dimethyl)silyl]oxy-2-chloro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
|---|---|
| PubChem CID | 71282049 |
| Molecular Formula | C17H25ClO2Si |
| Molecular Weight | 324.92 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 9-[tert-butyl(dimethyl)silyl]oxy-2-chloro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCC(=O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H25ClO2Si/c1-17(2,3)21(4,5)20-16-8-6-7-15(19)13-10-9-12(18)11-14(13)16/h9-11,16H,6-8H2,1-5H3 |
| InChIKey | IJMPLTUFFGIQGD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.92 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|