C25H21F3N6O3S — CID 71282183
6-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[2-methyl-5-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]phenyl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 71282183) has the molecular formula C25H21F3N6O3S and a molecular weight of 542.54 g/mol. Its IUPAC name is 6-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[2-methyl-5-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]phenyl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 6-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[2-methyl-5-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]phenyl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71282183 |
| Molecular Formula | C25H21F3N6O3S |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | 6-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[2-methyl-5-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]phenyl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1nc(C)c(-c2ccc3ncc(C(=O)Nc4cc(-c5noc(COCC(F)(F)F)n5)ccc4C)n3c2)s1 |
| InChI | InChI=1S/C25H21F3N6O3S/c1-13-4-5-16(23-32-21(37-33-23)11-36-12-25(26,27)28)8-18(13)31-24(35)19-9-29-20-7-6-17(10-34(19)20)22-14(2)30-15(3)38-22/h4-10H,11-12H2,1-3H3,(H,31,35) |
| InChIKey | OLQYEJXCZQVYIV-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |