C21H31NO3Si — CID 71282247
8-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,9-dimethyl-3,4-dihydro-2H-oxepino[3,2-f]indol-5-one (PubChem CID 71282247) has the molecular formula C21H31NO3Si and a molecular weight of 373.57 g/mol. Its IUPAC name is 8-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,9-dimethyl-3,4-dihydro-2H-oxepino[3,2-f]indol-5-one.
| Compound Name | 8-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,9-dimethyl-3,4-dihydro-2H-oxepino[3,2-f]indol-5-one |
|---|---|
| PubChem CID | 71282247 |
| Molecular Formula | C21H31NO3Si |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 8-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,9-dimethyl-3,4-dihydro-2H-oxepino[3,2-f]indol-5-one |
| SMILES | CC1COc2cc3c(cc2C(=O)C1)cc(CO[Si](C)(C)C(C)(C)C)n3C |
| InChI | InChI=1S/C21H31NO3Si/c1-14-8-19(23)17-10-15-9-16(13-25-26(6,7)21(2,3)4)22(5)18(15)11-20(17)24-12-14/h9-11,14H,8,12-13H2,1-7H3 |
| InChIKey | BMHCNGKUBIRJEP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|