C10H21NO2Si2 — CID 71282514
5-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)oxolan-2-one (PubChem CID 71282514) has the molecular formula C10H21NO2Si2 and a molecular weight of 243.45 g/mol. Its IUPAC name is 5-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)oxolan-2-one.
| Compound Name | 5-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)oxolan-2-one |
|---|---|
| PubChem CID | 71282514 |
| Molecular Formula | C10H21NO2Si2 |
| Molecular Weight | 243.45 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 5-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)oxolan-2-one |
| SMILES | C[Si]1(C)CC[Si](C)(C)N1C1CCC(=O)O1 |
| InChI | InChI=1S/C10H21NO2Si2/c1-14(2)7-8-15(3,4)11(14)9-5-6-10(12)13-9/h9H,5-8H2,1-4H3 |
| InChIKey | RGGZCPPBLWUIMS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|