C16H14Cl2N4O2 — CID 71282654
6-(3,4-dichlorophenyl)-N-[(2S)-pyrrolidine-2-carbonyl]pyrimidine-4-carboxamide (PubChem CID 71282654) has the molecular formula C16H14Cl2N4O2 and a molecular weight of 365.22 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)-N-[(2S)-pyrrolidine-2-carbonyl]pyrimidine-4-carboxamide.
| Compound Name | 6-(3,4-dichlorophenyl)-N-[(2S)-pyrrolidine-2-carbonyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 71282654 |
| Molecular Formula | C16H14Cl2N4O2 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 6-(3,4-dichlorophenyl)-N-[(2S)-pyrrolidine-2-carbonyl]pyrimidine-4-carboxamide |
| SMILES | O=C(NC(=O)[C@@H]1CCCN1)c1cc(-c2ccc(Cl)c(Cl)c2)ncn1 |
| InChI | InChI=1S/C16H14Cl2N4O2/c17-10-4-3-9(6-11(10)18)13-7-14(21-8-20-13)16(24)22-15(23)12-2-1-5-19-12/h3-4,6-8,12,19H,1-2,5H2,(H,22,23,24)/t12-/m0/s1 |
| InChIKey | PTPCIBJMAKHRKQ-LBPRGKRZSA-N |
| XLogP | 2.46 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|