About 2,4-dihydroindeno[1,2-c]pyrazole-3-carboxamide
2,4-dihydroindeno[1,2-c]pyrazole-3-carboxamide (PubChem CID 71282697) has the molecular formula C11H9N3O
and a molecular weight of 199.21 g/mol. Its IUPAC name is 2,4-dihydroindeno[1,2-c]pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 2,4-dihydroindeno[1,2-c]pyrazole-3-carboxamide |
| PubChem CID | 71282697 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 2,4-dihydroindeno[1,2-c]pyrazole-3-carboxamide |
| SMILES | NC(=O)c1[nH]nc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C11H9N3O/c12-11(15)10-8-5-6-3-1-2-4-7(6)9(8)13-14-10/h1-4H,5H2,(H2,12,15)(H,13,14) |
| InChIKey | XKAUUIZIUYKFMA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dihydroindeno[1,2-c]pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dihydroindeno[1,2-c]pyrazole-3-carboxamide?
The IUPAC name of 2,4-dihydroindeno[1,2-c]pyrazole-3-carboxamide (CID 71282697) is 2,4-dihydroindeno[1,2-c]pyrazole-3-carboxamide.
What is the SMILES notation for 2,4-dihydroindeno[1,2-c]pyrazole-3-carboxamide?
The canonical SMILES for 2,4-dihydroindeno[1,2-c]pyrazole-3-carboxamide is NC(=O)c1[nH]nc2c1Cc1ccccc1-2.
What is the InChIKey of 2,4-dihydroindeno[1,2-c]pyrazole-3-carboxamide?
The InChIKey is XKAUUIZIUYKFMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O/c12-11(15)10-8-5-6-3-1-2-4-7(6)9(8)13-14-10/h1-4H,5H2,(H2,12,15)(H,13,14).
What are the key properties of 2,4-dihydroindeno[1,2-c]pyrazole-3-carboxamide?
2,4-dihydroindeno[1,2-c]pyrazole-3-carboxamide has a molecular weight of 199.21 g/mol, XLogP of 1.08, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydroindeno[1,2-c]pyrazole-3-carboxamide is sourced from PubChem (CID 71282697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).