C13H11Cl2NO2 — CID 71283288
methyl 5,7-dichloro-4-(methylamino)naphthalene-2-carboxylate (PubChem CID 71283288) has the molecular formula C13H11Cl2NO2 and a molecular weight of 284.14 g/mol. Its IUPAC name is methyl 5,7-dichloro-4-(methylamino)naphthalene-2-carboxylate.
| Compound Name | methyl 5,7-dichloro-4-(methylamino)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 71283288 |
| Molecular Formula | C13H11Cl2NO2 |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | methyl 5,7-dichloro-4-(methylamino)naphthalene-2-carboxylate |
| SMILES | CNc1cc(C(=O)OC)cc2cc(Cl)cc(Cl)c12 |
| InChI | InChI=1S/C13H11Cl2NO2/c1-16-11-5-8(13(17)18-2)3-7-4-9(14)6-10(15)12(7)11/h3-6,16H,1-2H3 |
| InChIKey | WCXSHGYAZLTZRD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |