About [(1R)-1-amino-2-benzyl-3-fluoro-2-(fluoromethyl)propyl] 2,2,2-trifluoroacetate
[(1R)-1-amino-2-benzyl-3-fluoro-2-(fluoromethyl)propyl] 2,2,2-trifluoroacetate (PubChem CID 71283768) has the molecular formula C13H14F5NO2
and a molecular weight of 311.25 g/mol. Its IUPAC name is [(1R)-1-amino-2-benzyl-3-fluoro-2-(fluoromethyl)propyl] 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | [(1R)-1-amino-2-benzyl-3-fluoro-2-(fluoromethyl)propyl] 2,2,2-trifluoroacetate |
| PubChem CID | 71283768 |
| Molecular Formula | C13H14F5NO2 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | [(1R)-1-amino-2-benzyl-3-fluoro-2-(fluoromethyl)propyl] 2,2,2-trifluoroacetate |
| SMILES | N[C@H](OC(=O)C(F)(F)F)C(CF)(CF)Cc1ccccc1 |
| InChI | InChI=1S/C13H14F5NO2/c14-7-12(8-15,6-9-4-2-1-3-5-9)10(19)21-11(20)13(16,17)18/h1-5,10H,6-8,19H2/t10-/m1/s1 |
| InChIKey | MFWTXIDVFKCMGW-SNVBAGLBSA-N |
| XLogP | 2.54 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-amino-2-benzyl-3-fluoro-2-(fluoromethyl)propyl] 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-amino-2-benzyl-3-fluoro-2-(fluoromethyl)propyl] 2,2,2-trifluoroacetate?
The IUPAC name of [(1R)-1-amino-2-benzyl-3-fluoro-2-(fluoromethyl)propyl] 2,2,2-trifluoroacetate (CID 71283768) is [(1R)-1-amino-2-benzyl-3-fluoro-2-(fluoromethyl)propyl] 2,2,2-trifluoroacetate.
What is the SMILES notation for [(1R)-1-amino-2-benzyl-3-fluoro-2-(fluoromethyl)propyl] 2,2,2-trifluoroacetate?
The canonical SMILES for [(1R)-1-amino-2-benzyl-3-fluoro-2-(fluoromethyl)propyl] 2,2,2-trifluoroacetate is N[C@H](OC(=O)C(F)(F)F)C(CF)(CF)Cc1ccccc1.
What is the InChIKey of [(1R)-1-amino-2-benzyl-3-fluoro-2-(fluoromethyl)propyl] 2,2,2-trifluoroacetate?
The InChIKey is MFWTXIDVFKCMGW-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H14F5NO2/c14-7-12(8-15,6-9-4-2-1-3-5-9)10(19)21-11(20)13(16,17)18/h1-5,10H,6-8,19H2/t10-/m1/s1.
What are the key properties of [(1R)-1-amino-2-benzyl-3-fluoro-2-(fluoromethyl)propyl] 2,2,2-trifluoroacetate?
[(1R)-1-amino-2-benzyl-3-fluoro-2-(fluoromethyl)propyl] 2,2,2-trifluoroacetate has a molecular weight of 311.25 g/mol, XLogP of 2.54, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-amino-2-benzyl-3-fluoro-2-(fluoromethyl)propyl] 2,2,2-trifluoroacetate is sourced from PubChem (CID 71283768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).