About ethyl 2-(4-ethylsulfanyl-2,6-difluorophenyl)acetate
ethyl 2-(4-ethylsulfanyl-2,6-difluorophenyl)acetate (PubChem CID 71283945) has the molecular formula C12H14F2O2S
and a molecular weight of 260.30 g/mol. Its IUPAC name is ethyl 2-(4-ethylsulfanyl-2,6-difluorophenyl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(4-ethylsulfanyl-2,6-difluorophenyl)acetate |
| PubChem CID | 71283945 |
| Molecular Formula | C12H14F2O2S |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | ethyl 2-(4-ethylsulfanyl-2,6-difluorophenyl)acetate |
| SMILES | CCOC(=O)Cc1c(F)cc(SCC)cc1F |
| InChI | InChI=1S/C12H14F2O2S/c1-3-16-12(15)7-9-10(13)5-8(17-4-2)6-11(9)14/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | JUSSFITUKGPZCJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-(4-ethylsulfanyl-2,6-difluorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-ethylsulfanyl-2,6-difluorophenyl)acetate?
The IUPAC name of ethyl 2-(4-ethylsulfanyl-2,6-difluorophenyl)acetate (CID 71283945) is ethyl 2-(4-ethylsulfanyl-2,6-difluorophenyl)acetate.
What is the SMILES notation for ethyl 2-(4-ethylsulfanyl-2,6-difluorophenyl)acetate?
The canonical SMILES for ethyl 2-(4-ethylsulfanyl-2,6-difluorophenyl)acetate is CCOC(=O)Cc1c(F)cc(SCC)cc1F.
What is the InChIKey of ethyl 2-(4-ethylsulfanyl-2,6-difluorophenyl)acetate?
The InChIKey is JUSSFITUKGPZCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2O2S/c1-3-16-12(15)7-9-10(13)5-8(17-4-2)6-11(9)14/h5-6H,3-4,7H2,1-2H3.
What are the key properties of ethyl 2-(4-ethylsulfanyl-2,6-difluorophenyl)acetate?
ethyl 2-(4-ethylsulfanyl-2,6-difluorophenyl)acetate has a molecular weight of 260.30 g/mol, XLogP of 3.18, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-ethylsulfanyl-2,6-difluorophenyl)acetate is sourced from PubChem (CID 71283945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).