C12H16BNO6S — CID 71284050
2-[(3R)-2-hydroxy-3-[(2-thiophen-2-ylacetyl)amino]-1,5,2-dioxaborepan-7-yl]acetic acid (PubChem CID 71284050) has the molecular formula C12H16BNO6S and a molecular weight of 313.14 g/mol. Its IUPAC name is 2-[(3R)-2-hydroxy-3-[(2-thiophen-2-ylacetyl)amino]-1,5,2-dioxaborepan-7-yl]acetic acid.
| Compound Name | 2-[(3R)-2-hydroxy-3-[(2-thiophen-2-ylacetyl)amino]-1,5,2-dioxaborepan-7-yl]acetic acid |
|---|---|
| PubChem CID | 71284050 |
| Molecular Formula | C12H16BNO6S |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-[(3R)-2-hydroxy-3-[(2-thiophen-2-ylacetyl)amino]-1,5,2-dioxaborepan-7-yl]acetic acid |
| SMILES | O=C(O)CC1COC[C@H](NC(=O)Cc2cccs2)B(O)O1 |
| InChI | InChI=1S/C12H16BNO6S/c15-11(5-9-2-1-3-21-9)14-10-7-19-6-8(4-12(16)17)20-13(10)18/h1-3,8,10,18H,4-7H2,(H,14,15)(H,16,17)/t8?,10-/m0/s1 |
| InChIKey | HTRNKEKGRLWABE-HTLJXXAVSA-N |
| XLogP | -0.31 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|