C14H19BN2O6S — CID 71284083
2-[(3R)-5-acetyl-2-hydroxy-3-[(2-thiophen-2-ylacetyl)amino]-1,5,2-oxazaborepan-7-yl]acetic acid (PubChem CID 71284083) has the molecular formula C14H19BN2O6S and a molecular weight of 354.19 g/mol. Its IUPAC name is 2-[(3R)-5-acetyl-2-hydroxy-3-[(2-thiophen-2-ylacetyl)amino]-1,5,2-oxazaborepan-7-yl]acetic acid.
| Compound Name | 2-[(3R)-5-acetyl-2-hydroxy-3-[(2-thiophen-2-ylacetyl)amino]-1,5,2-oxazaborepan-7-yl]acetic acid |
|---|---|
| PubChem CID | 71284083 |
| Molecular Formula | C14H19BN2O6S |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-[(3R)-5-acetyl-2-hydroxy-3-[(2-thiophen-2-ylacetyl)amino]-1,5,2-oxazaborepan-7-yl]acetic acid |
| SMILES | CC(=O)N1CC(CC(=O)O)OB(O)[C@@H](NC(=O)Cc2cccs2)C1 |
| InChI | InChI=1S/C14H19BN2O6S/c1-9(18)17-7-10(5-14(20)21)23-15(22)12(8-17)16-13(19)6-11-3-2-4-24-11/h2-4,10,12,22H,5-8H2,1H3,(H,16,19)(H,20,21)/t10?,12-/m0/s1 |
| InChIKey | YEUAMVLLYJUTQQ-KFJBMODSSA-N |
| XLogP | -0.48 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|