C16H14N2O5 — CID 71284617
4-hydroxy-5-methoxy-6-(1-methylindol-5-yl)-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 71284617) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is 4-hydroxy-5-methoxy-6-(1-methylindol-5-yl)-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 4-hydroxy-5-methoxy-6-(1-methylindol-5-yl)-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 71284617 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 4-hydroxy-5-methoxy-6-(1-methylindol-5-yl)-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | COc1c(-c2ccc3c(ccn3C)c2)[nH]c(=O)c(C(=O)O)c1O |
| InChI | InChI=1S/C16H14N2O5/c1-18-6-5-8-7-9(3-4-10(8)18)12-14(23-2)13(19)11(16(21)22)15(20)17-12/h3-7H,1-2H3,(H,21,22)(H2,17,19,20) |
| InChIKey | DJUWJLHJZXSKQT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |