C22H24N2O4 — CID 71285154
methyl 5-ethyl-4-hydroxy-6-(9-methyl-5,6,7,8-tetrahydrocarbazol-3-yl)-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 71285154) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is methyl 5-ethyl-4-hydroxy-6-(9-methyl-5,6,7,8-tetrahydrocarbazol-3-yl)-2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | methyl 5-ethyl-4-hydroxy-6-(9-methyl-5,6,7,8-tetrahydrocarbazol-3-yl)-2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 71285154 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | methyl 5-ethyl-4-hydroxy-6-(9-methyl-5,6,7,8-tetrahydrocarbazol-3-yl)-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | CCc1c(-c2ccc3c(c2)c2c(n3C)CCCC2)[nH]c(=O)c(C(=O)OC)c1O |
| InChI | InChI=1S/C22H24N2O4/c1-4-13-19(23-21(26)18(20(13)25)22(27)28-3)12-9-10-17-15(11-12)14-7-5-6-8-16(14)24(17)2/h9-11H,4-8H2,1-3H3,(H2,23,25,26) |
| InChIKey | RPNCNTMYVXTJCP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|