C23H27N3O3 — CID 71285312
15-[(tert-butylamino)methyl]-14-methyl-4-oxo-3,14-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2(7),5,12,15,17-hexaene-5-carboxylic acid (PubChem CID 71285312) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 15-[(tert-butylamino)methyl]-14-methyl-4-oxo-3,14-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2(7),5,12,15,17-hexaene-5-carboxylic acid.
| Compound Name | 15-[(tert-butylamino)methyl]-14-methyl-4-oxo-3,14-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2(7),5,12,15,17-hexaene-5-carboxylic acid |
|---|---|
| PubChem CID | 71285312 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 15-[(tert-butylamino)methyl]-14-methyl-4-oxo-3,14-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2(7),5,12,15,17-hexaene-5-carboxylic acid |
| SMILES | Cn1c(CNC(C)(C)C)cc2cc3c(cc21)CCCc1cc(C(=O)O)c(=O)[nH]c1-3 |
| InChI | InChI=1S/C23H27N3O3/c1-23(2,3)24-12-16-8-15-10-17-13(11-19(15)26(16)4)6-5-7-14-9-18(22(28)29)21(27)25-20(14)17/h8-11,24H,5-7,12H2,1-4H3,(H,25,27)(H,28,29) |
| InChIKey | ZUPQCMHSFCVFOF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |