C21H33NO2Si — CID 71285552
2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[f]indol-5-ol (PubChem CID 71285552) has the molecular formula C21H33NO2Si and a molecular weight of 359.59 g/mol. Its IUPAC name is 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[f]indol-5-ol.
| Compound Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[f]indol-5-ol |
|---|---|
| PubChem CID | 71285552 |
| Molecular Formula | C21H33NO2Si |
| Molecular Weight | 359.59 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[f]indol-5-ol |
| SMILES | Cn1c(CO[Si](C)(C)C(C)(C)C)cc2cc3c(cc21)CCCCC3O |
| InChI | InChI=1S/C21H33NO2Si/c1-21(2,3)25(5,6)24-14-17-11-16-12-18-15(13-19(16)22(17)4)9-7-8-10-20(18)23/h11-13,20,23H,7-10,14H2,1-6H3 |
| InChIKey | WDUFKKBICYJDCL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.59 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|