C16H12F3N5O2 — CID 71285654
2-[[amino-[1-[(2,3-difluorophenyl)methyl]-5-fluoropyrazolo[5,4-b]pyridin-3-yl]methylidene]amino]acetic acid (PubChem CID 71285654) has the molecular formula C16H12F3N5O2 and a molecular weight of 363.30 g/mol. Its IUPAC name is 2-[[amino-[1-[(2,3-difluorophenyl)methyl]-5-fluoropyrazolo[5,4-b]pyridin-3-yl]methylidene]amino]acetic acid.
| Compound Name | 2-[[amino-[1-[(2,3-difluorophenyl)methyl]-5-fluoropyrazolo[5,4-b]pyridin-3-yl]methylidene]amino]acetic acid |
|---|---|
| PubChem CID | 71285654 |
| Molecular Formula | C16H12F3N5O2 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-[[amino-[1-[(2,3-difluorophenyl)methyl]-5-fluoropyrazolo[5,4-b]pyridin-3-yl]methylidene]amino]acetic acid |
| SMILES | N/C(=N\CC(=O)O)c1nn(Cc2cccc(F)c2F)c2ncc(F)cc12 |
| InChI | InChI=1S/C16H12F3N5O2/c17-9-4-10-14(15(20)21-6-12(25)26)23-24(16(10)22-5-9)7-8-2-1-3-11(18)13(8)19/h1-5H,6-7H2,(H2,20,21)(H,25,26) |
| InChIKey | SUKZXGDJEAOTQE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|